nwaku/waku/v2/protocol/waku_rln_relay/waku_rln_relay_types.nim

369 lines
21 KiB
Nim
Raw Normal View History

2021-07-22 08:43:41 +00:00
{.push raises: [Defect].}
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
import
std/tables,
2021-07-22 08:43:41 +00:00
options, chronos, stint,
web3,
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
eth/keys,
libp2p/protobuf/minprotobuf,
stew/arrayops,
../../utils/protobuf
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## Bn256 and RLN are Nim wrappers for the data types used in
## the rln library https://github.com/kilic/rln/blob/3bbec368a4adc68cd5f9bfae80b17e1bbb4ef373/src/ffi.rs
type Bn256* = pointer
type RLN*[E] = pointer
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
type
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
# identity key as defined in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Membership
IDKey* = array[32, byte]
# hash of identity key as defined ed in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Membership
IDCommitment* = array[32, byte]
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
type
MerkleNode* = array[32, byte] # Each node of the Merkle tee is a Poseidon hash which is a 32 byte value
Nullifier* = array[32, byte]
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
ZKSNARK* = array[256, byte]
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
Epoch* = array[32, byte]
# Custom data types defined for waku rln relay -------------------------
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
type MembershipKeyPair* = object
## user's identity key (a secret key) which is selected randomly
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
## see details in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Membership
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
idKey*: IDKey
# hash of user's identity key generated by
# Poseidon hash function implemented in rln lib
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
# more details in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Membership
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
idCommitment*: IDCommitment
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
type RateLimitProof* = object
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## RateLimitProof holds the public inputs to rln circuit as
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
## defined in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Public-Inputs
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## the `proof` field carries the actual zkSNARK proof
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
proof*: ZKSNARK
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## the root of Merkle tree used for the generation of the `proof`
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
merkleRoot*: MerkleNode
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## the epoch used for the generation of the `proof`
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
epoch*: Epoch
## shareX and shareY are shares of user's identity key
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
## these shares are created using Shamir secret sharing scheme
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
## see details in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Linear-Equation-amp-SSS
shareX*: MerkleNode
shareY*: MerkleNode
## nullifier enables linking two messages published during the same epoch
## see details in https://hackmd.io/tMTLMYmTR5eynw2lwK9n1w?view#Nullifiers
nullifier*: Nullifier
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
type MembershipIndex* = uint
type ProofMetadata* = object
nullifier*: Nullifier
shareX*: MerkleNode
shareY*: MerkleNode
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
type WakuRLNRelay* = ref object
membershipKeyPair*: MembershipKeyPair
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
# membershipIndex denotes the index of a leaf in the Merkle tree
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
# that contains the pk of the current peer
# this index is used to retrieve the peer's authentication path
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
membershipIndex*: MembershipIndex
membershipContractAddress*: Address
ethClientAddress*: string
ethAccountAddress*: Address
# this field is required for signing transactions
# TODO may need to erase this ethAccountPrivateKey when is not used
# TODO may need to make ethAccountPrivateKey mandatory
Feat(rln-relay): enables two modes of onchain and offchain (#992) * adds the contract handler file * adds integration test for the group listening * adds groupManagement proc * deletes rln relay contract handler file * brings back all the tests * replaces toUINT256 with getIdCommitment proc * replaces individual futures with an array of futures * adds code documentation * asyncSpawn instead of await * adds untitest for toIDCommitment and toUInt256 * reorganizes the test and add rlnInstance * mounts handleGroupUpdates on the rln peer * asyncSpawn to await * implements toIDCommitment * updates the unittest * improves the code documentation * removes unused tests * WIP * uncomments the tests * defines a new mountRlnRelayStatic proc * splits mountRlnRelay into two procs for dynamic and static group management * adds a config for off-chain and on-chain rln-relay * runs dynamic or static mode of rln-relay based on the input config * adds Eth private key and account configs * reads Eth private key and account the configs * comments put the second register proc * add proper call to the rlnrelay dynamic mode * adds todo * adds new rln relay configs * splits register into two procs * makes eth account private key non-optional * removes getIdCommitment and edits the register proc * removes getIdCommitment calls * uncomments the commented tests * fixes a bug * removes contract deployment for the offchain test * fixes a bug, edits comments * removes custom types without proper parsing and serialization routines from the configs * fixes a bug * switches to stew byte utils * removes log decoding * WIP * updates register proc * edits test titles * removes eth private key config * changes the output of register proc to return the registered index * integrates the registration process into mountRlnRelayDynamic * integration test for the register proc * brings back the onchain tests * updates comments * cleans up * disambiguates the Address type namespace * fixes type ambiguities * adds default values for rln key and index * updates config descriptions * adds type conversion from hex to MembershipKeyPair * adds more code documentation * passed the group value instead of option to the mount proc * fix a bug * a minor input type fix for rln chat2 * groups let declarations * adds default values for addresses * logs registered keys
2022-06-17 22:00:19 +00:00
ethAccountPrivateKey*: PrivateKey
rlnInstance*: RLN[Bn256]
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
pubsubTopic*: string # the pubsub topic for which rln relay is mounted
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
# contentTopic should be of type waku_message.ContentTopic, however, due to recursive module dependency, the underlying type of ContentTopic is used instead
# TODO a long-term solution is to place types with recursive dependency inside one file
contentTopic*: string
# the log of nullifiers and Shamir shares of the past messages grouped per epoch
nullifierLog*: Table[Epoch, seq[ProofMetadata]]
type MessageValidationResult* {.pure.} = enum
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
Valid, Invalid, Spam
# inputs of the membership contract constructor
# TODO may be able to make these constants private and put them inside the waku_rln_relay_utils
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
const
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
MEMBERSHIP_FEE* = 5.u256
# the current implementation of the rln lib only supports a circuit for Merkle tree with depth 32
MERKLE_TREE_DEPTH* = 20
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
# TODO the ETH_CLIENT should be an input to the rln-relay, though hardcoded for now
# the current address is the address of ganache-cli when run locally
ETH_CLIENT* = "ws://localhost:8540/"
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
const
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
# the size of poseidon hash output in bits
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
HASH_BIT_SIZE* = 256
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
# the size of poseidon hash output as the number hex digits
HASH_HEX_SIZE* = int(HASH_BIT_SIZE/4)
# temporary variables to test waku-rln-relay performance in the static group mode
const
STATIC_GROUP_SIZE* = 100
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
# STATIC_GROUP_KEYS is a static list of 100 membership keys in the form of (identity key, identity commitment)
# keys are created locally, using createMembershipList proc from waku_rln_relay_utils module, and the results are hardcoded in here
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
# this list is temporary and is created to test the performance of waku-rln-relay for the static groups
# in the later versions, this static hardcoded group will be replaced with a dynamic one
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
STATIC_GROUP_KEYS* = @[("e9a4d05b1f539d65c59015a079ee89aabeafbcfc9734342d9559f81601e85417",
"b74d3a5b3200ab1126fbee393496f33da497d4d9a7c56693f44d6155c0c34e13"), (
"27b2bfc25257e53819beaf36ce1070007e04e7aad2e440a1f1fc066f59a61123",
"522ce51aff96041e79a8476f508fb9661f146f189e288f83cb4837517cfc0127"), (
"66392eaae6674267c55fe393d39443ba90317a709d6e8f92a9f3e4abc18eff1d",
"e3dc235e48c1811943fc249fecd0f1415a50ebe839ccefb0bd820a76fb77ba2a"), (
"e7462eebb81405230db8014b052d65fe7b269c3870e40b12cf64668ed6c2d40e",
"727df0965e34144ea637be18208cc81e57e423010b3159c20f0ccff45c42212a"), (
"1ad8528b4c7075013a2d6561a02517b0482c0733dc018ac68774db857deb5004",
"5df3a77577135784da2a9ee78f5026092b7d6bb9e6e95882d6cb172c0cb62208"), (
"aa0ff53bfc50861f871d94df18c3ac0b97f44ceb13436b33490cec5f6ce8e700",
"30421d05b905aeaec0473ba29ace034bf73c406866d7dc23007eb9c34a596827"), (
"0448c0a6ed57b177c4c45de478b58d29f24e7ea842814305443e87188ae24324",
"5ea1a704d8972af5a028367c8e3fb48ee61a603c6ea3a4c9247b0f611a6ab002"), (
"4b6a6edbdd11e69befe3f4a3c976baca320c4bcb188f129b603ebb198f663000",
"451d6185e8ad2c8873f034683b9caca43ea7ceb1b839abd3e01c3f19f3e6bd1e"), (
"c3fba34855b33f025696326d2980ddc3fb47d90459ed6a4488fbb2e4e12ccf2b",
"74674a86144ea866ad8fe633e256783bda4a07b997cb412c53a5eaf4cc7b6a0e"), (
"0c35b8b94a720f1c26d7c6241c9f3ea5332a87cf3730b25ef31b68854c10e405",
"6915df8d8ad19ec17be37c299eed762f9b63e841cd7963e13e8db6890dba082d"), (
"a60b021677da95ba46c8c3411ac77f3e3b06937a8d189517111c045880029909",
"bbfcd22ecb44cec6fd0717cd0f21b26e6e8b2c91e1a6cb5d8610e2f2ad41c90f"), (
"2f4d662e66fbe754b708b87ea3d75a01d2ea4d7bf33c615c2376211dcc3b560f",
"c67f7e622c3293028b9f86571e82c49551eb5fd308a35eb663498cffac208810"), (
"d90a1afa96c14c8d3b989a9cf23d6e8b9907da42724e44a3ac74ae015b6ce22e",
"f0795b1bdd0a907252b6ab047642d97be076a16ea69d463f1a4bec00c817202e"), (
"dfa0764d89c8da10777504e5274f1baccf8b4145deba72b26503474318fb6410",
"9f8aa8e833ea2f13cccfb6d9f2f04fd7be9c9f3019540c05c1986b3bce254e25"), (
"e17490013b6b53a40964ff1067b922d4d73521e32fe394527b39c1bfd4a5e712",
"7a8fa23a0e4b14a36f2818a7d98639f6e4934c028da780a6cc658fbf76e80a26"), (
"7a9328d1075373dddb1b1100e8217ffaa1f9b632911b95a8fdc08870b15a8410",
"94b2ae70c046b94873098c19fe18e7b17db2d31fe6a7eb73fea8168395e3c122"), (
"ce319bb1447da5bf51a88ab3379dbea539b5a431d3c4f131048cf7b05c52161d",
"cdfa264ab8a51bbc9fff5732cf544bb06abba7e807a8c252a5f9ce785c6ff22c"), (
"d3818503bfcbef9ca03fc4472be77cb4936a1720001fc5e54852f769448fd313",
"e72792abd906976c75a5670de514894a720c5293cf74338a9c2987640a949c0b"), (
"4f9b8d118460736eb62602d12d3aed62938d4d4374b8c88704cf40c415c0901e",
"2ecbe4588ade31924a1053fe0204950a0b4924878b312e56b2d0522f92a5f01c"), (
"39b59fd96adaf9633edcc8cef10049cddf5f7df8ac80af8aafa436d62ee7f905",
"b94f7a979df8a95fc2766a9a96308ff39a14daf7b7d6bc48591d2ea4c764bf00"), (
"73cb0d25995d182b361c8237852bafeab8bb951de99f730da2913a239400c322",
"da04e6e4446b6bcd54667b741444d826abbc5b76572d28474dfa94db91144606"), (
"2753423b83bba5bb8b2799bc58125c46fb03ec05e8579d772cdc6e75b0875009",
"ee040010ec20e7293431a3692d06416f71162d176a316b0329a76edf6f3fb30d"), (
"cb73ec9b67355ce6275b51144a0759de28bb9390aab20514ee49a3bd8ce5361b",
"c7c6e2ad3efe1f03b398241bddb67b008dd5e8caf1a17db9c33d2e2388d58e0d"), (
"bdb386d9f3fe5613ede926d80246682a5d32392f7f6c9d818a80d8e7a12e371b",
"21d48c74f422ef72cb9db18799916b3c11d0cb99cec808563e2db22047840902"), (
"60f2fcfe341034449046c1fa330f6aceff737a9837a7d6d3a4885f8afce4a809",
"e4c8f26f9e4127511b5ab21f1705913d7beaa2767cb7d033564e36bd2693370c"), (
"1223d64fb5c44921c1ae66d91543780634c2f7bae7e184e09c4e5447e6d1180b",
"290ab84714fc3534c5ba22b2aa7696ac03ed12c9cf1c409a777bac05475ea406"), (
"b79c593316c42280d316bb7f3b43c7a5f5e29786d1ca6c0424463470eefe2b2f",
"f4e44ac9574c4d32ab403e71dd00554eee0d8e34d04611b66ab2e59c49bff025"), (
"e6548f669ebe655cb6600432e1af14c43da7286e3620289b51cc947517db9c14",
"ace261e3964a1dcb389a693f52104018cd475e6856ae37fe4892df9482954902"), (
"81be54409c9364f4842209e0f79b190afd9df017cc9790e11196d4bf5108f100",
"d986b22e422703e065f12b6fd608813028ff913d4ffeb54b19e6537456391b23"), (
"940ff0d3b4549d1baf7ad900cf6aedde02833b777e39c411e6efe7bcdd2ef305",
"d672bb8a6e75b47fdbb365de0516f3fa827b287c9666e64d1b6768e2c8949412"), (
"b4fe300aa1c8c836b3cc4c167df86d08fb7213200b8d9f7ba7963170e6dc8c0a",
"5f7db6a9867f3f5c9fd1955c02cf96056d1225be950cd432818f8f1c16152020"), (
"2c34a2bdb3738cb78270207dcae40ae47178bf4216bd2044ba124ec49240522a",
"8c490c78d7d735ab32493510cc2ec9c3742d3f47e46cfd754859e91271673e15"), (
"fc03857a3ff92d17d40bf9bb9b99e01e85fe4c698450147dc74cde60b2e9fa2d",
"c0a22acdababbc42bba5bc0245a2ef9f2c74b215663440aed37c8e0bd7e00809"), (
"a267a96a35c63b03788e90bb9a440da9ac832b0be02537b6f0ecc928ea989223",
"636ceacda5bce999ca303b7df32e9352af10083c6db6ed93c8a221efc385172d"), (
"ce4e15a2c1667a9dac4c4732de6c91f8c523c449f8c9be6b895644460717a209",
"d55c6523f40b36d2519b30292873bd469aeda6dbdbafe7c5fd405438dcc6bd12"), (
"4c617cdea4e3cb008c396c59b701375409304d84cfa17fe9d6d91a15fa412306",
"a6dc21a9c35418a39c69f2d8e9df738db0b36fecc44eddf364846b84c5362819"), (
"8c33aa2b3d94f9b11cc62ed1a304b92be370384ebbbf67c886dcd6ce544cc806",
"7caca2b1ab8c70b58ba36794a988fd6ec50c2a04dd09d7cd28e67ca1f1401d2c"), (
"1b6fc8f4007e6cdcf89a496cf0e711b0a3bbdbbae66830450a9744f5c802a228",
"c3b79478bd32feb99a0c92001efb97953efdad8c2338ed2ac14a313592c12418"), (
"0c6837e83ee0f1b1e5fe31bdf0960aefa2162ef7de7c0c886df930839bd4db06",
"8b2667b5151ab13f0f87fb014cd3ebb7ab1e92a528f00ebd91b514ea61b8f52b"), (
"8da38060963597c34544d8b10432a2e34d8eada7d1479f4fa5e96dca32250c27",
"7bf525115a8e6f772feb6d4db0f2a6b0d4233e0ff85e180c3249e18f0d08f42e"), (
"50b0c6d85f6a9d11fc52f1fc9e43b778380bdf936ddfd293940c77e79bc8340d",
"bbb9e297de81ef341e032484d7b33b29e7d9e3be1414feaf2bbc0957ba408811"), (
"6e8fd3ad20cf32ff8ba6e4bd8d4f05f3cc20d88631cbd3aa5f7f98446d725108",
"a9fe7404613b040412049a205301f2175b53d7012087047a8dc7501a381f5210"), (
"c291bb32d69cfef7e80b6dadd2a1198d05ac23eb30be6503d1c4c04350de2028",
"f44f8ca09d849551f72a6692c793319eefaa0c02d3301ae79c2f869f4251d422"), (
"116d4c2e21101f819a87f0de31dec56a4649c9ad9e539b71680dd439b288681d",
"9f4df65e05390be63bd6e3e38d8afb6117d5d357d56f35ecf63406096fdd810c"), (
"1813ed3760299a16e623084a852de9b12caaf8138744f8903a357fa9a2dbb00c",
"f37baacccd07bc489f50b851f807c88a425e41dd9dda8068e75cffb8bf653a0f"), (
"545e62d72cbb89db1c17e7ad8bb0660a74f8bc411b16eb0452d9a2d7c3e5b01e",
"96ddc93a86b091c7b1951d7371f80a352d85c38606e450aa2af272e8929fae19"), (
"0f5d5941474697c21ea6aecc29ff7cadbd28dbf29531431a40aaea3b7acd1514",
"e83d0ff3ab4db81fb19c1b6125d7d2e4a34a83a8d463049d06df4870dbb2a525"), (
"52605bc1f48092f9d5ad4c2a840a60f129e6aef2eef9c92474951ed1e10e381c",
"222df3afb8b20685c872f29ebfc7e4056fcdafe1d8a77a9f9ba08ac8f426190c"), (
"eee8cdee57e9f11ad0174c1514bba4c3a2c2a10d099876195726217445462f0b",
"a000e5799ac933154bae228c09b522c714fb9a57f530d1954947277be9db0a24"), (
"8c7d04dc3916370f8186dcffc92ad482294ab49c9ce36a5bd13473dc7c4d491a",
"788e35bcd82efbce15b3444f36330337ce3adb67bfc6329149cd25069ac9eb19"), (
"004a720f9edabb7f82eb30a78da45aceccbca5eb69583e1e8018ec1359a61f27",
"e3d319d64bea8069a649acd33859b22361da799e0296f3d4f5117e16feb18e16"), (
"38716f1d7cde7e37795a5b2d6d6317eecbf0adc6dcf7dcc6ee02cc25d1efb22f",
"95c229d0cfc1485f2be0a23de6e49601a2ea55652beead84a67cd727c21a1301"), (
"22cac7a49e99f3d071812abb0addafa4bf9a65308769728e4cd53cc7486f6c13",
"a2e5b90606809964bc20d776b9cbcaab93a2f25124998ae3bd698d061f7afd00"), (
"5109c7a41f73baa4787358b72ff1095439602add7a86a034b87b74360ee2e20f",
"a31b3e2033ed828b5a51b9428f8f6ea40267259df08fdcd2c0e34dd335bdf90c"), (
"957a87470f29a135567085c3d6d6ed14885bab4eb659725534a45a9f100a471c",
"8f3005df282d5a87fa33405e35a313233d05731e87cfcbe060fa067596fa3013"), (
"e0dad57606c2b293dc7c841c965cb29736d2411003e9284a0ae94d13e3d03d2e",
"0543643ef0b617030dcc292451ebcace8bad20706528cb6aedb98dcea66aba27"), (
"f1f10938c8a55b6b15b3f12beebb702133401135937c5c3f2d7fba702f24da09",
"dc862a8a5ad5107421d550731a7f561e4064878c3654bf88b230cc249e91091d"), (
"4bbc08d78c9970235778d6bd9939c7b2b1bd88b9d1cde6473663ae96ae776911",
"3584be9ce31a7fb3aae8515011f4d3eeb86a573b225a88577e4911050bc35013"), (
"c8325b31c9295757ca23d8f5256eebc5ccc517d28e00bfda5f4d709441d66713",
"b81f360903160485c470625519cb18219b44d8b740273ef742fefc5653daf009"), (
"69a6b3e22fbe5879efa56cdb5d50605732bf7f311e28ba037916b4db61ae8a14",
"10ddf800eb3e67da20575456150cb1f0d49506d97ed4ef2d91b951af48966924"), (
"c2a0e3586d4bb49f2ef979686c3a9a1619d0d54ac89641d592b4628b19dee401",
"bc3ba677f6d13ef9f023d4a3b9f073c3eea910ef90cfd24b7f54414d2d02d315"), (
"5b89051b79ff37457760d7af2ebc68be955e47eb6cdf306fbd369dc19fc52c05",
"7bfe2a9d5bb2ade0f9058ea27a07c867af21670d2b9e84bdcc8967d4cdc4ba11"), (
"46ac45f35cbc23bf68906933ad29240054a0a1d89c1832ebb54aa1bc32644105",
"e891e783d5615a1b8ab838f68f6f2ce4e359510ddd40882d4650327d08a5bd11"), (
"581e067b37c40caf861c190922f816e6cb850540df7ceb159f96c48c1c70cd23",
"0d49fa8c74202369c36f4121eab0aa3ac9206ad3419fc9517a88493b07d6fb25"), (
"bb7eb4ba2b45a22e14fad963c04eadbe8e7aab6ff912b008c9e7dd2a2c7d3615",
"758ed0c8cef51f82508072fa758265f0f0eef6c7b2401b94ebe27a638ce33125"), (
"a08f3cc9904f672b94d1f5a14dedbdef4ed229da5b66eca0135090d6f0ba0728",
"542c952395d241cfa15bd48922e9c7fc292dbdd120daa3d66dad67fb3abb700a"), (
"105bac5c449441bd5f5cf39b431f703e2e8f6a30a90d86cfdf425ec728fdbd08",
"b59206f1d556fb98329a7111e3c89bf1e6a4861ec38c82eafa81cff70b713e0d"), (
"45df2edfaea234dab99efa9a402c0d2feaa841ff3c990c926473173283d95913",
"db008cf922c3a50549373a14f5f18b2dc827bd6e168402dfe3e6ece4cb137527"), (
"488dd6437c15ef5b85e84407b7e599cc078c195ed2fc27b366ddac7739f1eb14",
"0448887f55c677464e7e540adf107ba10fc6713e8a2718fe92cbd4794ef4be17"), (
"3fe697698f3504e15eb5d509efa91624d9aa4eae24beeb42ffcb3c6ea8372a30",
"441ccb28e7c6c1893a58f7513c9b7c1c5d0adf3de452644a837d7e08e1ab8117"), (
"9bb5801272264c74db75f1c6812747bf338ea6880fa4dd2d51ef651ef73c2e04",
"e2eefd80e838c30b3f1fb0313fcfcb1e1556439d0346d17334df83c33247b20e"), (
"bad37a1467c4fe875b78508656f2816414ef602ae2ccd4e9430d94ca5c1cd911",
"21c72ccdbaed2e3ea9dac3881531467b64c9322199127f2ae2fa4bb31bad591d"), (
"95c72237ccbaedc185b1abfc59059c454175df81bb3ff65e5a61e2cb5263ed0d",
"1040728a4775ac5cf7a9c75dda2f0aee1fabd6b202b5e916636e3aec73a09d0d"), (
"738e8b9af4d199bc95f70b2a9b25e999b39af15c6a02f2eca058326078745f2a",
"004835960aa03e101d818907df453cefdfb910b44ad9bd056a83b2ef40a5ca0d"), (
"0d88caf486f2fe60bfc08697d1b617b586ec880e38e4ff56f145a5db0ab6d12e",
"a7b19323815295bc84c50535b62c3d4d53dbfc434441eb3c009568fb8f7b2b1a"), (
"b37af7fd314d90590fba8ebf730397cfdaa97f86d3f31d1a7ddc817ff303791f",
"8296a80eceae97f92784642da34f121e29db2c5f3baf9a2722896db22e98b703"), (
"6b67dd3051a8cb113431f5a14e279d910b7b4798ccb03ff588cf312ffe366a0b",
"9c38cc543a0b793be4a0d66de3b2cd30b1f33d36c4402a165da924d7e6f89a12"), (
"72fc4c40e406b9d1b34daba614460922fc53951abd6db5834e1f1b07fa319f27",
"daa4d50481ba47c4a78ae3848a9b268b1d8e0579b4967ebcdece47d386410d02"), (
"a4ce5cb2b2a23dcf019f275058a4092901c4793e6ee7d29282e755dd0d0df000",
"00749453d23051f3587911c34d52e2c2d093273d2283cd6dfba94d7a89cdb226"), (
"9e00df0216e8ac8e72abfeab1106373a13699714c691f04a549f6b58ea974521",
"0e69dbfd9023b8bb58ce7e17972d7c94d49e8464f9c22161d7564ed32c53ef27"), (
"fe1a558c6315f425fea7c04dcf6db869acd7b62b1b848200d5709e73d53de71b",
"66cd33cc8d61cb807092d76ac0e506014fc55624a39ee2afa67f9ba58eb21022"), (
"3ca542e17e4cbc74f47afb399b12295d15dfbae5e966509b7e6cae2df61a430a",
"57a0df429ed3720dee61ca720a4617243b41472f0c7766cc7ce625afddb3b41b"), (
"c1a77855e9b0b1f7381c9acd69ff68fdfa65f1f753dcea22de5a28ed088c2b2e",
"4fce521d725abb8a30d8c39a2a22f496b374d8512b7a76afd3803f7200c86d19"), (
"17cda8d590adf3042bbf1452fe3d79b959f284f3df1e15ee3c696286f0ba832e",
"8919e92a175b55003379ca6e546a04228aa9da861a9669e0e9b106e4a204d404"), (
"959fa9337b4b479ce5fcff7ff9096a344acf7fcde2f8852e28904236472f2f02",
"79e688ecfece239223b745e4b95460bfcb02aee12b154e15db616fda857dcd06"), (
"d062d34cbdfbc50004a631e3dd8f21b446673b53830aa71fdcbc741e7d4fb31c",
"2203af0127657f4e8a1c5ec44bb25028e64ad388efd0b9bfe2105f4f3ff66d0f"), (
"d2d3e3034864944914709549ce27068b5f27bd18b0edc940593df2dc5c5dae23",
"5ae75206bfdc8f54a8673d5d4c4b464ba1e84ae2410418b5c5e98fa993608113"), (
"4ab457d6478fb27214345f0bc2e00cbb29cd55bed1f8e05c23b8f7810e134a1f",
"3db37711e355ed46ea81bb6e31ae87b37b706a8d17e2aa976c7c7706c8e18d19"), (
"5aa17884c96ecdaf81e2b343dbf051e4ace41935e53378ac10a4387e2cb0c404",
"7118986268a748881f6144fc1008e90b40afc702be53784ed4cbceb8606e0714"), (
"82f4ca6b751ac067e451ae1d5115806e7a1d14ab444084a8ac48046b88b43b30",
"8a09186c2a5cb0f16e273be6a8710620006a77afe7c54149bea3dce906345a02"), (
"55d5d97de81e0cc4d2ac97e507d4d6d9874cb55e1522b89ed2050ff3c20a4912",
"27facefe4e2041e11a21889205af6c11eba73e3e8779b801bf3f7253730f1d04"), (
"845177f4584f61071ddea21e9a6c0a17e1a9408e0c073047c339498ff383c109",
"25bc572d1c861fe80156c2fd440e7d9110be8252723d276e806dcc012f8da103"), (
"ecec46dfdaf45f49f82ee78fd9c8c747c049de9becaf440f90391c04dd119002",
"b922e1a7caf72db69dcc062424c7ce75728d010c4c201c2ed8e635a617c81a1f"), (
"8e265fd9f2a4b158a5eb4bda000a6124af909e118b7510f0ec418559aad85825",
"aed92a21e9933bd2ce6c9f09bb7753b46ea31248b324c12726cff08e464bdd0c"), (
"99d7181572d3ae637a277dcc0c35b9b98bbb6ecf3cdcc69af3e946a5bfeb520f",
"89217b554371a2495ee473f867b2e26ea70d4245aceb462a98dd31a37d2d5330"), (
"a5e1fd149ae27f34e7902ebf380277c0b7f09f37e8809d25a0b8df2965d24e29",
"2d6a16a254cfc3894d5500f8c40feb1e84876bc51c68c381109e83f001b41c2f"), (
"7fd221da235bb6e5fd0ae047f1aa49615ddbeecfb71ccb976bf3e0534425661c",
"9ea41ccc3e09572927b0d9f618e1135d384f33618b6a0f80002f0a70be5eb324"), (
"b125c1b45daa68f96be6a5b3e4dd24e4a0e49e46226d841eb73754a498c43b21",
"360b9c39d25451ae58cf651c530155f91e324292b55475a92506de726f153c18"), (
"d64536234849ababefa90b84f7b7cacf4b073809aa9b0c35581426521f18d81a",
"d2dae030312cd4325bb036aa3436b26b9bed69b4d78d68bd49dbdde3173f1510"), (
"d1ce3aea6cfb7be132d17e8d76fcbe4b7e34cef3979b4b905acfeff2f6d19724",
"be47b76297791f535f4b56f973a19f07ec22d4eede2a41ff23c696089938bb21")]
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
# STATIC_GROUP_MERKLE_ROOT is the root of the Merkle tree constructed from the STATIC_GROUP_KEYS above
# only identity commitments are used for the Merkle tree construction
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
# the root is created locally, using createMembershipList proc from waku_rln_relay_utils module, and the result is hardcoded in here
STATIC_GROUP_MERKLE_ROOT* = "a1877a553eff12e1b21632a0545a916a5c5b8060ad7cc6c69956741134397b2d"
Off-chain group construction and management (#718) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * converts var to let when applicable * replaces hardcoded value with well-defined constants * moves createMembershipList to the rln relay utils module * renames HashSize to HashHexSize * minor updates on the comments * reorganizes the consts * indicates that rlnRelayMemIndex is an experimental option * fixes a type conversion bug * revises the unittest of "mount waku rln-relay off-chain" * clarifies the use of index * updates a docstring * removes redundant constants and capitalize all of them * deletes the ETH_CLIENT const from the test file * renames a few vars for the sake of clarity * reorganizes unittest into blocks of execution, debug messages, and checks * adds more comments * more comments and clarifications * cleans up the tests * minor * adds a minor fix * replaces a var usage with let * fixes a bug
2021-09-17 17:31:25 +00:00
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
const EPOCH_UNIT_SECONDS* = float64(10) # the rln-relay epoch length in seconds
Updates rln-chat2 interface (#846) * adds ProofMetadata * adds EPOCH_INTERVAL * adds messageLog field * adds updateLog, toEpoch, fromEpoch, getEpoch, compareTo * adds unit test for toEpoch and fromEpoch * adds unit test for Epoch comparison * adds result codes for updateLog * adds unit test for update log * renames epoch related consts * modifies updateLog with new return type and new logic of spam detection * adds unit text for the modified updateLog * changes max epoch gap type size * splits updateLog into two procs isSpam and updateLog * updates unittests * fixes a bug, returns false when the message is not spam * renames messageLog to nullifierLog * renames isSpam to hasDuplicate * updates the rln validator, adds comments * adds appendRLNProof proc plus some code beatification * unit test for validate message * adds unhappy test to validateMessage unit test * renames EPOCH_UNIT_SECONDS * renames MAX_CLOCK_GAP_SECONDS * WIP: integration test * fixes compile errors * sets a real epoch value * updates on old unittests * adds comments to the rln relay tests * adds more comments * makes rln import conditional * adds todos * adds more todos * adds rln-relay mount process into chat2 * further todos * logs contentTopic * introduces rln relay configs * changes default pubsub topic * adds contentTopic config * imports rln relay dependencies * consolidates imports * removes module identifier from ContentTopic * adds contentTopic field * adds contentTopic argument to mountRlnRelay calls * appends rln proof to chat2 messages * changes the default chat2 contentTopic * adds missing content topic fields * fixes a bug * adds a new logic about empty content topics * appends proof only when rln flag is active * removes unnecessary todos * fixes an indentation issue * adds log messages * verifies the proof against the concatenation of msg payload and content topic * a bug fix * WIP * removes duplicate epoch time calculation * converts echo to log * invokes handler * bug fix * prints calculated epoch * changes the format of printed epoch * updates log levels * logs the input buffer supplied to the generate_proof * replaces echos with logs * changes log level to trace * resets the log level of chat2 to INFO * upgrades log level to debug * exports toRLNSignal and adds a doc string * updates log level * enables all test2 * removes an echo statement * modifies a comment * further updates on the log level * a minor update * invokes the spam handler when provided * checks for payload version * deletes a redundant check * deletes a rendant check * updates default rln-relay cht2 content topic * adds a todo and log * changes the case of testnet content topic * removes a flaky check
2022-02-16 22:52:21 +00:00
const MAX_CLOCK_GAP_SECONDS* = 20.0 # the maximum clock difference between peers in seconds
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
# maximum allowed gap between the epochs of messages' RateLimitProofs
const MAX_EPOCH_GAP* = int64(MAX_CLOCK_GAP_SECONDS/EPOCH_UNIT_SECONDS)
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
# Protobufs enc and init
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
proc init*(T: type RateLimitProof, buffer: seq[byte]): ProtoResult[T] =
var nsp: RateLimitProof
let pb = initProtoBuffer(buffer)
var proof: seq[byte]
discard ? pb.getField(1, proof)
discard nsp.proof.copyFrom(proof)
var merkleRoot: seq[byte]
discard ? pb.getField(2, merkleRoot)
discard nsp.merkleRoot.copyFrom(merkleRoot)
var epoch: seq[byte]
discard ? pb.getField(3, epoch)
discard nsp.epoch.copyFrom(epoch)
var shareX: seq[byte]
discard ? pb.getField(4, shareX)
discard nsp.shareX.copyFrom(shareX)
var shareY: seq[byte]
discard ? pb.getField(5, shareY)
discard nsp.shareY.copyFrom(shareY)
var nullifier: seq[byte]
discard ? pb.getField(6, nullifier)
discard nsp.nullifier.copyFrom(nullifier)
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
return ok(nsp)
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
proc encode*(nsp: RateLimitProof): ProtoBuffer =
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
var output = initProtoBuffer()
output.write3(1, nsp.proof)
output.write3(2, nsp.merkleRoot)
output.write3(3, nsp.epoch)
output.write3(4, nsp.shareX)
output.write3(5, nsp.shareY)
output.write3(6, nsp.nullifier)
output.finish3()
Integrates proof generation and verification into wakunode2 (#735) * WIP * WIP: fixes a bug * adds test for static group formation * adds static group creation when rln-relay is enabled * adds createStatic group * wip: adds group formation to mount rlnrelay * adds createMembershipList utility function * adds doc strings and todos * cleans up the code and add comments * defaults createRLNInstance depth argument to 32 * renames Depth * distinguishes between onchain and offchain modes * updates index boundaries * updates log levels * updates docstring * updates log level of displayed membership keys * relocates a todo * activates all the tests * fixes some comments and todos * extracts some utils procs for better debugging * adds todo * moves calculateMerkleRoot and toMembersipKeyPairs to the rln utils * makes calls to the utils functions * adds unit test for createMembershipList * adds unittest for toMembershipKeyPairs and calcMerkleRoot * cleans up the code and fixes tree root value * reverts an unwanted change * minor * adds comments and cleans up the code * updates config message * adds more comments * fixes a minor value mismatch * edits the size of group * minor rewording * defines a const var for the group keys * replaces the sequence literal with the StaticGroupKeys const * adds a rudimentary unittest * adds todos * adds more comment * replaces uint with MembeshipIndex type * fixes rln relay mem index config message * adds rln relay setup proc * decouples relay and rln-relay * uses MemIndexType instead of uint * brings back the rlnRelayEnabled flag to mountRlnRelay * deletes commented codes * adds rln relay topic validator inside updates rln relay mounting procedure * adds rln-relay-pubsub-topic cli option * adds a static rln-relay topic * deletes rlnrelayEnabled argument * adds pubsub topic for rln-relay * deletes static pubsub topic * mounts relay before rlnrelay in the tests * logs rln relay pubsub topic * cleans up the code * edits rlnrelay setup * uninitializes the input parameter of rlnrelay setup * adds comments * removes unused comments * compiles addRLNRelayValidtor when RLN compilation flag is set * adds comment about topic validator * minor * mode modifications on the description of add validator * adds pubsubtopic field to wakuRlnRelay type * WIP: shaping the test * Checks whether rln relay pubsub topic is within the supported topics of relay protocol * minor * WIP: unit test for actual proof * fixes a bug * removes a redundant proc * refines the test for actual proof * breaks lines to 80 chars * defines NonSpamProof type * adds a return * defines Epoch type * WIP: proof gen * implements actual proof gen * adds proto enc and init * adds notes about proof structure * adds NonSpamProof to wakumessage * adds proof gen * WIP: non working tests for protobuf * fixes the protobuf encoding issue * discards the output of copyFrom * WIP: hash unittest and proofVrfy and ProofGen * integrates proofVrfy * uses toBuffer inside the hash proc * adds comment * fixes a bug * removes proof field initialization * cleans up the test * generalizes input from byte seq to byte openArray * adds toBuffer * adds a bad test * cleans up unused tests * adds integration test * adds comments * cleans up * adds description to the integration test * adds test for unhappy path * tides up the tests * tides up hash unit test * renames a few var * uses a const for wku rln relay pubsub topic * minor refinement * deletes an obsolete comment * comment revision * adds comments * cleans up and adds docstrings * profGen returns proofRes instead of proof * removes extra sleepAsync * fixes two bugs * returns reject when proof is not verified\ * addresses comments * adds comments * links to rln doc * more comments * fixes space format * uncomments v2 tests * dnsclient branch update * undo branch update * minor spacing fix * makes proof field conditional
2021-10-20 00:37:29 +00:00
chore|feat (waku-rln-relay): modules reorganization|Initial test for capturing events using nim-web3 (#941) * first edition * adds the full test scenario * fixes typos * fixes a bug in the supplied command * further edits the description * displays the chat prompt after spam detection * updates changelog * minor wording fix * adds a new test file for onchain rln relay * adds the Event proc * adds one working example of event subscription * defines a new unitt test for event subscription * adds the new test file * cleans up the code * adds a working event subscription for faucet contract * wip * makes faucet test conditional * updates contract byte codes * adds a working test for event subscription and cleans up the tests * fixes case * adss toUInt256 unit function * enables the tests * fixes a bug * undo commented tests * cleans up the test * logs the pk * removes excess entry in the changelog * fixes spacing * comments * removes unused test codes * adds the conditional compilation for onchain tests * uncomments offchain tests * removes onchain tests * reorganizes the code and moves the rln contract data into a separate module * deletes txt files * beautifies the code * beautifies the code * removes an excess line * more formatting fixes * minor fix * updates the case of membership fee const * renames compare to diff * renames time to e * edits the number of arguments of the send proc * fixes a comment alignment * fixes indentation * fixed id style * splits check from condition * fixes a naming mismatch
2022-05-10 21:09:18 +00:00
return output