nim-eth/eth/p2p/peer_pool.nim
Kim De Mey d2ba753792
Add rlpx metrics and avoid immediate peer reconnections (#585)
* Add metrics related to devp2p peer connections

* Avoid reconnecting to peers that just failed connection

- Add SeenTable to avoid reconnecting to peers immediately after
a failed connect. Depending on the failure, the amount of time is
different. This is similar to what is done in nimbus-eth2.
- Attempt to rework rlpxConnect at the same time, in order to
make sure that errors are properly handled. The current structure
is far from ideal, but it is hopefully a small step in the right
direction. To many oddities in there right now to really rework
rlpxConnect properply.

* Fix rlpx thunk fuzzer
2023-03-16 16:45:12 +01:00

309 lines
10 KiB
Nim

# nim-eth
# Copyright (c) 2018-2021 Status Research & Development GmbH
# Licensed and distributed under either of
# * MIT license (license terms in the root directory or at https://opensource.org/licenses/MIT).
# * Apache v2 license (license terms in the root directory or at https://www.apache.org/licenses/LICENSE-2.0).
# at your option. This file may not be copied, modified, or distributed except according to those terms.
# PeerPool attempts to keep connections to at least min_peers
# on the given network.
{.push raises: [Defect].}
import
std/[os, tables, times, random, sequtils, options],
chronos, chronicles,
".."/[keys, common],
./private/p2p_types, "."/[discovery, kademlia, rlpx, enode]
logScope:
topics = "eth p2p peer_pool"
const
lookupInterval = 5
connectLoopSleep = chronos.milliseconds(2000)
maxConcurrentConnectionRequests = 40
sleepBeforeTryingARandomBootnode = chronos.milliseconds(3000)
## Period of time for dead / unreachable peers.
SeenTableTimeDeadPeer = chronos.minutes(10)
## Period of time for Useless peers, either because of no matching
## capabilities or on an irrelevant network.
SeenTableTimeUselessPeer = chronos.hours(24)
## Period of time for peers with a protocol error.
SeenTableTimeProtocolError = chronos.minutes(30)
## Period of time for peers with general disconnections / transport errors.
SeenTableTimeReconnect = chronos.minutes(5)
proc isSeen(p: PeerPool, nodeId: NodeId): bool =
## Returns ``true`` if ``nodeId`` present in SeenTable and time period is not
## yet expired.
let currentTime = now(chronos.Moment)
if nodeId notin p.seenTable:
false
else:
let item = try: p.seenTable[nodeId]
except KeyError: raiseAssert "checked with notin"
if currentTime >= item.stamp:
# Peer is in SeenTable, but the time period has expired.
p.seenTable.del(nodeId)
false
else:
true
proc addSeen(
p: PeerPool, nodeId: NodeId, period: chronos.Duration) =
## Adds peer with NodeId ``nodeId`` to SeenTable and timeout ``period``.
let item = SeenNode(nodeId: nodeId, stamp: now(chronos.Moment) + period)
withValue(p.seenTable, nodeId, entry) do:
if entry.stamp < item.stamp:
entry.stamp = item.stamp
do:
p.seenTable[nodeId] = item
proc newPeerPool*(
network: EthereumNode, networkId: NetworkId, keyPair: KeyPair,
discovery: DiscoveryProtocol, clientId: string, minPeers = 10): PeerPool =
new result
result.network = network
result.keyPair = keyPair
result.minPeers = minPeers
result.networkId = networkId
result.discovery = discovery
result.connQueue = newAsyncQueue[Node](maxConcurrentConnectionRequests)
result.connectedNodes = initTable[Node, Peer]()
result.connectingNodes = initHashSet[Node]()
result.observers = initTable[int, PeerObserver]()
proc nodesToConnect(p: PeerPool): seq[Node] =
p.discovery.randomNodes(p.minPeers).filterIt(it notin p.discovery.bootstrapNodes)
proc addObserver*(p: PeerPool, observerId: int, observer: PeerObserver) =
doAssert(observerId notin p.observers)
p.observers[observerId] = observer
if not observer.onPeerConnected.isNil:
for peer in p.connectedNodes.values:
if observer.protocol.isNil or peer.supports(observer.protocol):
observer.onPeerConnected(peer)
proc delObserver*(p: PeerPool, observerId: int) =
p.observers.del(observerId)
proc addObserver*(p: PeerPool, observerId: ref, observer: PeerObserver) =
p.addObserver(cast[int](observerId), observer)
proc delObserver*(p: PeerPool, observerId: ref) =
p.delObserver(cast[int](observerId))
template setProtocol*(observer: PeerObserver, Protocol: type) =
observer.protocol = Protocol.protocolInfo
proc stopAllPeers(p: PeerPool) {.async.} =
debug "Stopping all peers ..."
# TODO: ...
# await asyncio.gather(
# *[peer.stop() for peer in self.connected_nodes.values()])
# async def stop(self) -> None:
# self.cancel_token.trigger()
# await self.stop_all_peers()
proc connect(p: PeerPool, remote: Node): Future[Peer] {.async.} =
## Connect to the given remote and return a Peer instance when successful.
## Returns nil if the remote is unreachable, times out or is useless.
if remote in p.connectedNodes:
trace "skipping_connection_to_already_connected_peer", remote
return nil
if remote in p.connectingNodes:
# debug "skipping connection"
return nil
if p.isSeen(remote.id):
return nil
trace "Connecting to node", remote
p.connectingNodes.incl(remote)
let res = await p.network.rlpxConnect(remote)
p.connectingNodes.excl(remote)
# TODO: Probably should move all this logic to rlpx.nim
if res.isOk():
rlpx_connect_success.inc()
return res.get()
else:
rlpx_connect_failure.inc()
rlpx_connect_failure.inc(labelValues = [$res.error])
case res.error():
of UselessRlpxPeerError:
p.addSeen(remote.id, SeenTableTimeUselessPeer)
of TransportConnectError:
p.addSeen(remote.id, SeenTableTimeDeadPeer)
of RlpxHandshakeError, ProtocolError, InvalidIdentityError:
p.addSeen(remote.id, SeenTableTimeProtocolError)
of RlpxHandshakeTransportError,
P2PHandshakeError,
P2PTransportError,
PeerDisconnectedError,
TooManyPeersError:
p.addSeen(remote.id, SeenTableTimeReconnect)
return nil
proc lookupRandomNode(p: PeerPool) {.async.} =
discard await p.discovery.lookupRandom()
p.lastLookupTime = epochTime()
proc getRandomBootnode(p: PeerPool): Option[Node] =
if p.discovery.bootstrapNodes.len != 0:
result = option(p.discovery.bootstrapNodes.sample())
proc addPeer*(pool: PeerPool, peer: Peer) {.gcsafe.} =
doAssert(peer.remote notin pool.connectedNodes)
pool.connectedNodes[peer.remote] = peer
rlpx_connected_peers.inc()
for o in pool.observers.values:
if not o.onPeerConnected.isNil:
if o.protocol.isNil or peer.supports(o.protocol):
o.onPeerConnected(peer)
proc connectToNode*(p: PeerPool, n: Node) {.async.} =
let peer = await p.connect(n)
if not peer.isNil:
trace "Connection established (outgoing)", peer
p.addPeer(peer)
proc connectToNode*(p: PeerPool, n: ENode) {.async.} =
await p.connectToNode(newNode(n))
# This code is loosely based on code from nimbus-eth2;
# see eth2_network.nim and search for connQueue.
proc createConnectionWorker(p: PeerPool, workerId: int): Future[void] {.async.} =
trace "Connection worker started", workerId = workerId
while true:
let n = await p.connQueue.popFirst()
await connectToNode(p, n)
# # TODO: Consider changing connect() to raise an exception instead of
# # returning None, as discussed in
# # https://github.com/ethereum/py-evm/pull/139#discussion_r152067425
# echo "Connecting to node: ", node
# let peer = await p.connect(node)
# if not peer.isNil:
# info "Successfully connected to ", peer
# ensureFuture peer.run(p)
# p.connectedNodes[peer.remote] = peer
# # for subscriber in self._subscribers:
# # subscriber.register_peer(peer)
# if p.connectedNodes.len >= p.minPeers:
# return
proc startConnectionWorkerPool(p: PeerPool, workerCount: int) =
for i in 0 ..< workerCount:
asyncSpawn createConnectionWorker(p, i)
proc maybeConnectToMorePeers(p: PeerPool) {.async.} =
## Connect to more peers if we're not yet connected to at least self.minPeers.
if p.connectedNodes.len >= p.minPeers:
# debug "pool already connected to enough peers (sleeping)", count = p.connectedNodes
return
if p.lastLookupTime + lookupInterval < epochTime():
asyncSpawn p.lookupRandomNode()
let debugEnode = getEnv("ETH_DEBUG_ENODE")
if debugEnode.len != 0:
await p.connectToNode(newNode(debugEnode))
else:
for n in p.nodesToConnect():
await p.connQueue.addLast(n)
# The old version of the code (which did all the connection
# attempts in serial, not parallel) actually *awaited* all
# the connection attempts before reaching the code at the
# end of this proc that tries a random bootnode. Should
# that still be what happens? I don't think so; one of the
# reasons we're doing the connection attempts concurrently
# is because sometimes the attempt takes a long time. Still,
# it seems like we should give the many connection attempts
# a *chance* to complete before moving on to trying a random
# bootnode. So let's try just waiting a few seconds. (I am
# really not sure this makes sense.)
#
# --Adam, Dec. 2022
await sleepAsync(sleepBeforeTryingARandomBootnode)
# In some cases (e.g ROPSTEN or private testnets), the discovery table might
# be full of bad peers, so if we can't connect to any peers we try a random
# bootstrap node as well.
if p.connectedNodes.len == 0 and (let n = p.getRandomBootnode(); n.isSome):
await p.connectToNode(n.get())
proc run(p: PeerPool) {.async.} =
trace "Running PeerPool..."
p.running = true
p.startConnectionWorkerPool(maxConcurrentConnectionRequests)
while p.running:
debug "Amount of peers", amount = p.connectedNodes.len()
var dropConnections = false
try:
await p.maybeConnectToMorePeers()
except CatchableError as e:
# Most unexpected errors should be transient, so we log and restart from
# scratch.
error "Unexpected PeerPool error, restarting",
err = e.msg, stackTrace = e.getStackTrace()
dropConnections = true
if dropConnections:
await p.stopAllPeers()
await sleepAsync(connectLoopSleep)
proc start*(p: PeerPool) =
if not p.running:
asyncSpawn p.run()
proc len*(p: PeerPool): int = p.connectedNodes.len
# @property
# def peers(self) -> List[BasePeer]:
# peers = list(self.connected_nodes.values())
# # Shuffle the list of peers so that dumb callsites are less likely to send
# # all requests to
# # a single peer even if they always pick the first one from the list.
# random.shuffle(peers)
# return peers
# async def get_random_peer(self) -> BasePeer:
# while not self.peers:
# self.logger.debug("No connected peers, sleeping a bit")
# await asyncio.sleep(0.5)
# return random.choice(self.peers)
iterator peers*(p: PeerPool): Peer =
for remote, peer in p.connectedNodes:
yield peer
iterator peers*(p: PeerPool, Protocol: type): Peer =
for peer in p.peers:
if peer.supports(Protocol):
yield peer
func numPeers*(p: PeerPool): int =
p.connectedNodes.len
func contains*(p: PeerPool, n: ENode): bool =
for remote, _ in p.connectedNodes:
if remote.node == n:
return true
func contains*(p: PeerPool, n: Node): bool =
n in p.connectedNodes
func contains*(p: PeerPool, n: Peer): bool =
n.remote in p.connectedNodes